C16H16N4O6 — CID 19572404
(3,5-dinitrophenyl)-[4-(furan-2-ylmethyl)piperazin-1-yl]methanone (PubChem CID 19572404) has the molecular formula C16H16N4O6 and a molecular weight of 360.33 g/mol. Its IUPAC name is (3,5-dinitrophenyl)-[4-(furan-2-ylmethyl)piperazin-1-yl]methanone.
| Compound Name | (3,5-dinitrophenyl)-[4-(furan-2-ylmethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 19572404 |
| Molecular Formula | C16H16N4O6 |
| Molecular Weight | 360.33 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | (3,5-dinitrophenyl)-[4-(furan-2-ylmethyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)N1CCN(Cc2ccco2)CC1 |
| InChI | InChI=1S/C16H16N4O6/c21-16(12-8-13(19(22)23)10-14(9-12)20(24)25)18-5-3-17(4-6-18)11-15-2-1-7-26-15/h1-2,7-10H,3-6,11H2 |
| InChIKey | ALNBYVCCJXRBRY-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 122.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.33 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|