C19H23N3O7 — CID 46536275
[4-(furan-2-ylmethyl)piperazin-1-yl]-(3,4,5-trimethoxy-2-nitrophenyl)methanone (PubChem CID 46536275) has the molecular formula C19H23N3O7 and a molecular weight of 405.41 g/mol. Its IUPAC name is [4-(furan-2-ylmethyl)piperazin-1-yl]-(3,4,5-trimethoxy-2-nitrophenyl)methanone.
| Compound Name | [4-(furan-2-ylmethyl)piperazin-1-yl]-(3,4,5-trimethoxy-2-nitrophenyl)methanone |
|---|---|
| PubChem CID | 46536275 |
| Molecular Formula | C19H23N3O7 |
| Molecular Weight | 405.41 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | [4-(furan-2-ylmethyl)piperazin-1-yl]-(3,4,5-trimethoxy-2-nitrophenyl)methanone |
| SMILES | COc1cc(C(=O)N2CCN(Cc3ccco3)CC2)c([N+](=O)[O-])c(OC)c1OC |
| InChI | InChI=1S/C19H23N3O7/c1-26-15-11-14(16(22(24)25)18(28-3)17(15)27-2)19(23)21-8-6-20(7-9-21)12-13-5-4-10-29-13/h4-5,10-11H,6-9,12H2,1-3H3 |
| InChIKey | JNHCRTJEODDRFJ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 107.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.41 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|