C20H24N2O8 — CID 90483280
(2,6-dimethoxyphenyl)-[4-(furan-2-ylmethyl)piperazin-1-yl]methanone;oxalic acid (PubChem CID 90483280) has the molecular formula C20H24N2O8 and a molecular weight of 420.42 g/mol. Its IUPAC name is (2,6-dimethoxyphenyl)-[4-(furan-2-ylmethyl)piperazin-1-yl]methanone;oxalic acid.
| Compound Name | (2,6-dimethoxyphenyl)-[4-(furan-2-ylmethyl)piperazin-1-yl]methanone;oxalic acid |
|---|---|
| PubChem CID | 90483280 |
| Molecular Formula | C20H24N2O8 |
| Molecular Weight | 420.42 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | (2,6-dimethoxyphenyl)-[4-(furan-2-ylmethyl)piperazin-1-yl]methanone;oxalic acid |
| SMILES | COc1cccc(OC)c1C(=O)N1CCN(Cc2ccco2)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C18H22N2O4.C2H2O4/c1-22-15-6-3-7-16(23-2)17(15)18(21)20-10-8-19(9-11-20)13-14-5-4-12-24-14;3-1(4)2(5)6/h3-7,12H,8-11,13H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | NOCNEKYXYIGTFY-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 129.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.42 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|