C20H22N4O3 — CID 19515033
[4-(furan-2-ylmethyl)piperazin-1-yl]-[3-(3-methoxyphenyl)-1H-pyrazol-5-yl]methanone (PubChem CID 19515033) has the molecular formula C20H22N4O3 and a molecular weight of 366.42 g/mol. Its IUPAC name is [4-(furan-2-ylmethyl)piperazin-1-yl]-[3-(3-methoxyphenyl)-1H-pyrazol-5-yl]methanone.
| Compound Name | [4-(furan-2-ylmethyl)piperazin-1-yl]-[3-(3-methoxyphenyl)-1H-pyrazol-5-yl]methanone |
|---|---|
| PubChem CID | 19515033 |
| Molecular Formula | C20H22N4O3 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | [4-(furan-2-ylmethyl)piperazin-1-yl]-[3-(3-methoxyphenyl)-1H-pyrazol-5-yl]methanone |
| SMILES | COc1cccc(-c2cc(C(=O)N3CCN(Cc4ccco4)CC3)[nH]n2)c1 |
| InChI | InChI=1S/C20H22N4O3/c1-26-16-5-2-4-15(12-16)18-13-19(22-21-18)20(25)24-9-7-23(8-10-24)14-17-6-3-11-27-17/h2-6,11-13H,7-10,14H2,1H3,(H,21,22) |
| InChIKey | CNFJSVTZMLAJLR-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |