C19H20N6O2 — CID 20906512
[3-(3-methoxyphenyl)-1H-pyrazol-5-yl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone (PubChem CID 20906512) has the molecular formula C19H20N6O2 and a molecular weight of 364.41 g/mol. Its IUPAC name is [3-(3-methoxyphenyl)-1H-pyrazol-5-yl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone.
| Compound Name | [3-(3-methoxyphenyl)-1H-pyrazol-5-yl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 20906512 |
| Molecular Formula | C19H20N6O2 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | [3-(3-methoxyphenyl)-1H-pyrazol-5-yl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone |
| SMILES | COc1cccc(-c2cc(C(=O)N3CCN(c4ncccn4)CC3)[nH]n2)c1 |
| InChI | InChI=1S/C19H20N6O2/c1-27-15-5-2-4-14(12-15)16-13-17(23-22-16)18(26)24-8-10-25(11-9-24)19-20-6-3-7-21-19/h2-7,12-13H,8-11H2,1H3,(H,22,23) |
| InChIKey | IKVHDVCYNRKTKL-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |