C22H21FN4O3 — CID 46969433
(3-fluorophenyl)-[4-[3-(3-methoxyphenyl)-1H-pyrazole-5-carbonyl]piperazin-1-yl]methanone (PubChem CID 46969433) has the molecular formula C22H21FN4O3 and a molecular weight of 408.43 g/mol. Its IUPAC name is (3-fluorophenyl)-[4-[3-(3-methoxyphenyl)-1H-pyrazole-5-carbonyl]piperazin-1-yl]methanone.
| Compound Name | (3-fluorophenyl)-[4-[3-(3-methoxyphenyl)-1H-pyrazole-5-carbonyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 46969433 |
| Molecular Formula | C22H21FN4O3 |
| Molecular Weight | 408.43 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | (3-fluorophenyl)-[4-[3-(3-methoxyphenyl)-1H-pyrazole-5-carbonyl]piperazin-1-yl]methanone |
| SMILES | COc1cccc(-c2cc(C(=O)N3CCN(C(=O)c4cccc(F)c4)CC3)[nH]n2)c1 |
| InChI | InChI=1S/C22H21FN4O3/c1-30-18-7-3-4-15(13-18)19-14-20(25-24-19)22(29)27-10-8-26(9-11-27)21(28)16-5-2-6-17(23)12-16/h2-7,12-14H,8-11H2,1H3,(H,24,25) |
| InChIKey | HRIOYQASJPRHCL-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 78.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.43 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |