C19H19ClN4O2 — CID 19515009
[3-(4-chlorophenyl)-1H-pyrazol-5-yl]-[4-(furan-2-ylmethyl)piperazin-1-yl]methanone (PubChem CID 19515009) has the molecular formula C19H19ClN4O2 and a molecular weight of 370.84 g/mol. Its IUPAC name is [3-(4-chlorophenyl)-1H-pyrazol-5-yl]-[4-(furan-2-ylmethyl)piperazin-1-yl]methanone.
| Compound Name | [3-(4-chlorophenyl)-1H-pyrazol-5-yl]-[4-(furan-2-ylmethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 19515009 |
| Molecular Formula | C19H19ClN4O2 |
| Molecular Weight | 370.84 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | [3-(4-chlorophenyl)-1H-pyrazol-5-yl]-[4-(furan-2-ylmethyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1cc(-c2ccc(Cl)cc2)n[nH]1)N1CCN(Cc2ccco2)CC1 |
| InChI | InChI=1S/C19H19ClN4O2/c20-15-5-3-14(4-6-15)17-12-18(22-21-17)19(25)24-9-7-23(8-10-24)13-16-2-1-11-26-16/h1-6,11-12H,7-10,13H2,(H,21,22) |
| InChIKey | FZEMJVOSLKYLLO-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 65.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.84 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |