C21H20Cl2N4O — CID 19514994
[4-[(2-chlorophenyl)methyl]piperazin-1-yl]-[3-(4-chlorophenyl)-1H-pyrazol-5-yl]methanone (PubChem CID 19514994) has the molecular formula C21H20Cl2N4O and a molecular weight of 415.32 g/mol. Its IUPAC name is [4-[(2-chlorophenyl)methyl]piperazin-1-yl]-[3-(4-chlorophenyl)-1H-pyrazol-5-yl]methanone.
| Compound Name | [4-[(2-chlorophenyl)methyl]piperazin-1-yl]-[3-(4-chlorophenyl)-1H-pyrazol-5-yl]methanone |
|---|---|
| PubChem CID | 19514994 |
| Molecular Formula | C21H20Cl2N4O |
| Molecular Weight | 415.32 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | [4-[(2-chlorophenyl)methyl]piperazin-1-yl]-[3-(4-chlorophenyl)-1H-pyrazol-5-yl]methanone |
| SMILES | O=C(c1cc(-c2ccc(Cl)cc2)n[nH]1)N1CCN(Cc2ccccc2Cl)CC1 |
| InChI | InChI=1S/C21H20Cl2N4O/c22-17-7-5-15(6-8-17)19-13-20(25-24-19)21(28)27-11-9-26(10-12-27)14-16-3-1-2-4-18(16)23/h1-8,13H,9-12,14H2,(H,24,25) |
| InChIKey | DBRPTADCDIEBGG-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.32 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |