C22H21ClN4O3 — CID 20910976
(4-chlorophenyl)-[4-[3-(4-methoxyphenyl)-1H-pyrazole-5-carbonyl]piperazin-1-yl]methanone (PubChem CID 20910976) has the molecular formula C22H21ClN4O3 and a molecular weight of 424.89 g/mol. Its IUPAC name is (4-chlorophenyl)-[4-[3-(4-methoxyphenyl)-1H-pyrazole-5-carbonyl]piperazin-1-yl]methanone.
| Compound Name | (4-chlorophenyl)-[4-[3-(4-methoxyphenyl)-1H-pyrazole-5-carbonyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 20910976 |
| Molecular Formula | C22H21ClN4O3 |
| Molecular Weight | 424.89 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | (4-chlorophenyl)-[4-[3-(4-methoxyphenyl)-1H-pyrazole-5-carbonyl]piperazin-1-yl]methanone |
| SMILES | COc1ccc(-c2cc(C(=O)N3CCN(C(=O)c4ccc(Cl)cc4)CC3)[nH]n2)cc1 |
| InChI | InChI=1S/C22H21ClN4O3/c1-30-18-8-4-15(5-9-18)19-14-20(25-24-19)22(29)27-12-10-26(11-13-27)21(28)16-2-6-17(23)7-3-16/h2-9,14H,10-13H2,1H3,(H,24,25) |
| InChIKey | BGJKIOJLYXWSQD-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 78.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.89 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |