C19H17ClN4O2 — CID 2068775
N'-[1-(4-chlorophenyl)ethenyl]-3-(4-methoxyphenyl)-1H-pyrazole-5-carbohydrazide (PubChem CID 2068775) has the molecular formula C19H17ClN4O2 and a molecular weight of 368.82 g/mol. Its IUPAC name is N'-[1-(4-chlorophenyl)ethenyl]-3-(4-methoxyphenyl)-1H-pyrazole-5-carbohydrazide.
| Compound Name | N'-[1-(4-chlorophenyl)ethenyl]-3-(4-methoxyphenyl)-1H-pyrazole-5-carbohydrazide |
|---|---|
| PubChem CID | 2068775 |
| Molecular Formula | C19H17ClN4O2 |
| Molecular Weight | 368.82 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | N'-[1-(4-chlorophenyl)ethenyl]-3-(4-methoxyphenyl)-1H-pyrazole-5-carbohydrazide |
| SMILES | C=C(NNC(=O)c1cc(-c2ccc(OC)cc2)n[nH]1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H17ClN4O2/c1-12(13-3-7-15(20)8-4-13)21-24-19(25)18-11-17(22-23-18)14-5-9-16(26-2)10-6-14/h3-11,21H,1H2,2H3,(H,22,23)(H,24,25) |
| InChIKey | VGQIISLARJTQSX-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.82 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|