C21H22N4O2 — CID 2084076
3-(4-methoxyphenyl)-N'-(4-phenylbut-1-en-2-yl)-1H-pyrazole-5-carbohydrazide (PubChem CID 2084076) has the molecular formula C21H22N4O2 and a molecular weight of 362.43 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-N'-(4-phenylbut-1-en-2-yl)-1H-pyrazole-5-carbohydrazide.
| Compound Name | 3-(4-methoxyphenyl)-N'-(4-phenylbut-1-en-2-yl)-1H-pyrazole-5-carbohydrazide |
|---|---|
| PubChem CID | 2084076 |
| Molecular Formula | C21H22N4O2 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | 3-(4-methoxyphenyl)-N'-(4-phenylbut-1-en-2-yl)-1H-pyrazole-5-carbohydrazide |
| SMILES | C=C(CCc1ccccc1)NNC(=O)c1cc(-c2ccc(OC)cc2)n[nH]1 |
| InChI | InChI=1S/C21H22N4O2/c1-15(8-9-16-6-4-3-5-7-16)22-25-21(26)20-14-19(23-24-20)17-10-12-18(27-2)13-11-17/h3-7,10-14,22H,1,8-9H2,2H3,(H,23,24)(H,25,26) |
| InChIKey | YGIGONYAIPVWCT-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|