C16H16N6O3 — CID 78901393
N'-[3-(4-methoxyphenyl)-1H-pyrazole-5-carbonyl]-5-methyl-1H-pyrazole-3-carbohydrazide (PubChem CID 78901393) has the molecular formula C16H16N6O3 and a molecular weight of 340.34 g/mol. Its IUPAC name is N'-[3-(4-methoxyphenyl)-1H-pyrazole-5-carbonyl]-5-methyl-1H-pyrazole-3-carbohydrazide.
| Compound Name | N'-[3-(4-methoxyphenyl)-1H-pyrazole-5-carbonyl]-5-methyl-1H-pyrazole-3-carbohydrazide |
|---|---|
| PubChem CID | 78901393 |
| Molecular Formula | C16H16N6O3 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | N'-[3-(4-methoxyphenyl)-1H-pyrazole-5-carbonyl]-5-methyl-1H-pyrazole-3-carbohydrazide |
| SMILES | COc1ccc(-c2cc(C(=O)NNC(=O)c3cc(C)[nH]n3)[nH]n2)cc1 |
| InChI | InChI=1S/C16H16N6O3/c1-9-7-13(19-17-9)15(23)21-22-16(24)14-8-12(18-20-14)10-3-5-11(25-2)6-4-10/h3-8H,1-2H3,(H,17,19)(H,18,20)(H,21,23)(H,22,24) |
| InChIKey | VYQKOVIVEUXWGL-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|