C22H19N5O4 — CID 78870510
N'-[3-(4-methoxyphenyl)-1H-pyrazole-5-carbonyl]-3-(4-methylphenyl)-1,2-oxazole-5-carbohydrazide (PubChem CID 78870510) has the molecular formula C22H19N5O4 and a molecular weight of 417.43 g/mol. Its IUPAC name is N'-[3-(4-methoxyphenyl)-1H-pyrazole-5-carbonyl]-3-(4-methylphenyl)-1,2-oxazole-5-carbohydrazide.
| Compound Name | N'-[3-(4-methoxyphenyl)-1H-pyrazole-5-carbonyl]-3-(4-methylphenyl)-1,2-oxazole-5-carbohydrazide |
|---|---|
| PubChem CID | 78870510 |
| Molecular Formula | C22H19N5O4 |
| Molecular Weight | 417.43 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | N'-[3-(4-methoxyphenyl)-1H-pyrazole-5-carbonyl]-3-(4-methylphenyl)-1,2-oxazole-5-carbohydrazide |
| SMILES | COc1ccc(-c2cc(C(=O)NNC(=O)c3cc(-c4ccc(C)cc4)no3)[nH]n2)cc1 |
| InChI | InChI=1S/C22H19N5O4/c1-13-3-5-15(6-4-13)18-12-20(31-27-18)22(29)26-25-21(28)19-11-17(23-24-19)14-7-9-16(30-2)10-8-14/h3-12H,1-2H3,(H,23,24)(H,25,28)(H,26,29) |
| InChIKey | PFYNPHFTPHVBGE-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 122.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.43 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|