C18H22N4O3 — CID 78803224
N'-(2-cyclopentylacetyl)-3-(4-methoxyphenyl)-1H-pyrazole-5-carbohydrazide (PubChem CID 78803224) has the molecular formula C18H22N4O3 and a molecular weight of 342.40 g/mol. Its IUPAC name is N'-(2-cyclopentylacetyl)-3-(4-methoxyphenyl)-1H-pyrazole-5-carbohydrazide.
| Compound Name | N'-(2-cyclopentylacetyl)-3-(4-methoxyphenyl)-1H-pyrazole-5-carbohydrazide |
|---|---|
| PubChem CID | 78803224 |
| Molecular Formula | C18H22N4O3 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | N'-(2-cyclopentylacetyl)-3-(4-methoxyphenyl)-1H-pyrazole-5-carbohydrazide |
| SMILES | COc1ccc(-c2cc(C(=O)NNC(=O)CC3CCCC3)[nH]n2)cc1 |
| InChI | InChI=1S/C18H22N4O3/c1-25-14-8-6-13(7-9-14)15-11-16(20-19-15)18(24)22-21-17(23)10-12-4-2-3-5-12/h6-9,11-12H,2-5,10H2,1H3,(H,19,20)(H,21,23)(H,22,24) |
| InChIKey | IGQGLWFVHCSJJH-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|