C19H21F3N4O3 — CID 78887401
3-(4-methoxyphenyl)-N'-[3-(trifluoromethyl)cyclohexanecarbonyl]-1H-pyrazole-5-carbohydrazide (PubChem CID 78887401) has the molecular formula C19H21F3N4O3 and a molecular weight of 410.40 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-N'-[3-(trifluoromethyl)cyclohexanecarbonyl]-1H-pyrazole-5-carbohydrazide.
| Compound Name | 3-(4-methoxyphenyl)-N'-[3-(trifluoromethyl)cyclohexanecarbonyl]-1H-pyrazole-5-carbohydrazide |
|---|---|
| PubChem CID | 78887401 |
| Molecular Formula | C19H21F3N4O3 |
| Molecular Weight | 410.40 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 3-(4-methoxyphenyl)-N'-[3-(trifluoromethyl)cyclohexanecarbonyl]-1H-pyrazole-5-carbohydrazide |
| SMILES | COc1ccc(-c2cc(C(=O)NNC(=O)C3CCCC(C(F)(F)F)C3)[nH]n2)cc1 |
| InChI | InChI=1S/C19H21F3N4O3/c1-29-14-7-5-11(6-8-14)15-10-16(24-23-15)18(28)26-25-17(27)12-3-2-4-13(9-12)19(20,21)22/h5-8,10,12-13H,2-4,9H2,1H3,(H,23,24)(H,25,27)(H,26,28) |
| InChIKey | PVBCBLXGJKODKE-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.40 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|