C22H22N4O3 — CID 78847713
3-(4-methoxyphenyl)-N'-(1,2,3,4-tetrahydronaphthalene-1-carbonyl)-1H-pyrazole-5-carbohydrazide (PubChem CID 78847713) has the molecular formula C22H22N4O3 and a molecular weight of 390.44 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-N'-(1,2,3,4-tetrahydronaphthalene-1-carbonyl)-1H-pyrazole-5-carbohydrazide.
| Compound Name | 3-(4-methoxyphenyl)-N'-(1,2,3,4-tetrahydronaphthalene-1-carbonyl)-1H-pyrazole-5-carbohydrazide |
|---|---|
| PubChem CID | 78847713 |
| Molecular Formula | C22H22N4O3 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 3-(4-methoxyphenyl)-N'-(1,2,3,4-tetrahydronaphthalene-1-carbonyl)-1H-pyrazole-5-carbohydrazide |
| SMILES | COc1ccc(-c2cc(C(=O)NNC(=O)C3CCCc4ccccc43)[nH]n2)cc1 |
| InChI | InChI=1S/C22H22N4O3/c1-29-16-11-9-15(10-12-16)19-13-20(24-23-19)22(28)26-25-21(27)18-8-4-6-14-5-2-3-7-17(14)18/h2-3,5,7,9-13,18H,4,6,8H2,1H3,(H,23,24)(H,25,27)(H,26,28) |
| InChIKey | FDVJDAQRAGZJTH-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|