C21H18N6O3 — CID 78868431
N'-[3-(4-methoxyphenyl)-1H-pyrazole-5-carbonyl]-1-phenylpyrazole-3-carbohydrazide (PubChem CID 78868431) has the molecular formula C21H18N6O3 and a molecular weight of 402.41 g/mol. Its IUPAC name is N'-[3-(4-methoxyphenyl)-1H-pyrazole-5-carbonyl]-1-phenylpyrazole-3-carbohydrazide.
| Compound Name | N'-[3-(4-methoxyphenyl)-1H-pyrazole-5-carbonyl]-1-phenylpyrazole-3-carbohydrazide |
|---|---|
| PubChem CID | 78868431 |
| Molecular Formula | C21H18N6O3 |
| Molecular Weight | 402.41 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | N'-[3-(4-methoxyphenyl)-1H-pyrazole-5-carbonyl]-1-phenylpyrazole-3-carbohydrazide |
| SMILES | COc1ccc(-c2cc(C(=O)NNC(=O)c3ccn(-c4ccccc4)n3)[nH]n2)cc1 |
| InChI | InChI=1S/C21H18N6O3/c1-30-16-9-7-14(8-10-16)18-13-19(23-22-18)21(29)25-24-20(28)17-11-12-27(26-17)15-5-3-2-4-6-15/h2-13H,1H3,(H,22,23)(H,24,28)(H,25,29) |
| InChIKey | MIVAYHDLIYVFLF-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 113.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.41 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|