C20H24N6O3 — CID 78894033
3-tert-butyl-N'-[3-(4-methoxyphenyl)-1H-pyrazole-5-carbonyl]-1-methylpyrazole-5-carbohydrazide (PubChem CID 78894033) has the molecular formula C20H24N6O3 and a molecular weight of 396.45 g/mol. Its IUPAC name is 3-tert-butyl-N'-[3-(4-methoxyphenyl)-1H-pyrazole-5-carbonyl]-1-methylpyrazole-5-carbohydrazide.
| Compound Name | 3-tert-butyl-N'-[3-(4-methoxyphenyl)-1H-pyrazole-5-carbonyl]-1-methylpyrazole-5-carbohydrazide |
|---|---|
| PubChem CID | 78894033 |
| Molecular Formula | C20H24N6O3 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | 3-tert-butyl-N'-[3-(4-methoxyphenyl)-1H-pyrazole-5-carbonyl]-1-methylpyrazole-5-carbohydrazide |
| SMILES | COc1ccc(-c2cc(C(=O)NNC(=O)c3cc(C(C)(C)C)nn3C)[nH]n2)cc1 |
| InChI | InChI=1S/C20H24N6O3/c1-20(2,3)17-11-16(26(4)25-17)19(28)24-23-18(27)15-10-14(21-22-15)12-6-8-13(29-5)9-7-12/h6-11H,1-5H3,(H,21,22)(H,23,27)(H,24,28) |
| InChIKey | JFLQWWCKQSETIY-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 113.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|