C18H23FN4O3 — CID 87011046
3-tert-butyl-N'-[2-(4-fluorophenoxy)propanoyl]-1-methylpyrazole-5-carbohydrazide (PubChem CID 87011046) has the molecular formula C18H23FN4O3 and a molecular weight of 362.41 g/mol. Its IUPAC name is 3-tert-butyl-N'-[2-(4-fluorophenoxy)propanoyl]-1-methylpyrazole-5-carbohydrazide.
| Compound Name | 3-tert-butyl-N'-[2-(4-fluorophenoxy)propanoyl]-1-methylpyrazole-5-carbohydrazide |
|---|---|
| PubChem CID | 87011046 |
| Molecular Formula | C18H23FN4O3 |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | 3-tert-butyl-N'-[2-(4-fluorophenoxy)propanoyl]-1-methylpyrazole-5-carbohydrazide |
| SMILES | CC(Oc1ccc(F)cc1)C(=O)NNC(=O)c1cc(C(C)(C)C)nn1C |
| InChI | InChI=1S/C18H23FN4O3/c1-11(26-13-8-6-12(19)7-9-13)16(24)20-21-17(25)14-10-15(18(2,3)4)22-23(14)5/h6-11H,1-5H3,(H,20,24)(H,21,25) |
| InChIKey | VGTIEKDUSBQGLA-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|