C19H16N6O2 — CID 136575720
3-(4-methoxyphenyl)-N'-quinazolin-4-yl-1H-pyrazole-5-carbohydrazide (PubChem CID 136575720) has the molecular formula C19H16N6O2 and a molecular weight of 360.38 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-N'-quinazolin-4-yl-1H-pyrazole-5-carbohydrazide.
| Compound Name | 3-(4-methoxyphenyl)-N'-quinazolin-4-yl-1H-pyrazole-5-carbohydrazide |
|---|---|
| PubChem CID | 136575720 |
| Molecular Formula | C19H16N6O2 |
| Molecular Weight | 360.38 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 3-(4-methoxyphenyl)-N'-quinazolin-4-yl-1H-pyrazole-5-carbohydrazide |
| SMILES | COc1ccc(-c2cc(C(=O)NNc3ncnc4ccccc34)[nH]n2)cc1 |
| InChI | InChI=1S/C19H16N6O2/c1-27-13-8-6-12(7-9-13)16-10-17(23-22-16)19(26)25-24-18-14-4-2-3-5-15(14)20-11-21-18/h2-11H,1H3,(H,22,23)(H,25,26)(H,20,21,24) |
| InChIKey | ZJJGYEDYMDBUST-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 104.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.38 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|