C17H16N4O3 — CID 21002383
2-(2-methoxyphenoxy)-N'-quinazolin-4-ylacetohydrazide (PubChem CID 21002383) has the molecular formula C17H16N4O3 and a molecular weight of 324.34 g/mol. Its IUPAC name is 2-(2-methoxyphenoxy)-N'-quinazolin-4-ylacetohydrazide.
| Compound Name | 2-(2-methoxyphenoxy)-N'-quinazolin-4-ylacetohydrazide |
|---|---|
| PubChem CID | 21002383 |
| Molecular Formula | C17H16N4O3 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 2-(2-methoxyphenoxy)-N'-quinazolin-4-ylacetohydrazide |
| SMILES | COc1ccccc1OCC(=O)NNc1ncnc2ccccc12 |
| InChI | InChI=1S/C17H16N4O3/c1-23-14-8-4-5-9-15(14)24-10-16(22)20-21-17-12-6-2-3-7-13(12)18-11-19-17/h2-9,11H,10H2,1H3,(H,20,22)(H,18,19,21) |
| InChIKey | WJGOYRUMJBRUME-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|