C15H20N6O — CID 171933583
2-(4-methylpiperazin-1-yl)-N'-quinazolin-4-ylacetohydrazide (PubChem CID 171933583) has the molecular formula C15H20N6O and a molecular weight of 300.37 g/mol. Its IUPAC name is 2-(4-methylpiperazin-1-yl)-N'-quinazolin-4-ylacetohydrazide.
| Compound Name | 2-(4-methylpiperazin-1-yl)-N'-quinazolin-4-ylacetohydrazide |
|---|---|
| PubChem CID | 171933583 |
| Molecular Formula | C15H20N6O |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | 2-(4-methylpiperazin-1-yl)-N'-quinazolin-4-ylacetohydrazide |
| SMILES | CN1CCN(CC(=O)NNc2ncnc3ccccc23)CC1 |
| InChI | InChI=1S/C15H20N6O/c1-20-6-8-21(9-7-20)10-14(22)18-19-15-12-4-2-3-5-13(12)16-11-17-15/h2-5,11H,6-10H2,1H3,(H,18,22)(H,16,17,19) |
| InChIKey | GDILMYOUOQNUAI-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|