C15H11BrN4O — CID 75445250
3-bromo-N'-quinazolin-4-ylbenzohydrazide (PubChem CID 75445250) has the molecular formula C15H11BrN4O and a molecular weight of 343.18 g/mol. Its IUPAC name is 3-bromo-N'-quinazolin-4-ylbenzohydrazide.
| Compound Name | 3-bromo-N'-quinazolin-4-ylbenzohydrazide |
|---|---|
| PubChem CID | 75445250 |
| Molecular Formula | C15H11BrN4O |
| Molecular Weight | 343.18 g/mol |
| Exact Mass | 342.01 |
| IUPAC Name | 3-bromo-N'-quinazolin-4-ylbenzohydrazide |
| SMILES | O=C(NNc1ncnc2ccccc12)c1cccc(Br)c1 |
| InChI | InChI=1S/C15H11BrN4O/c16-11-5-3-4-10(8-11)15(21)20-19-14-12-6-1-2-7-13(12)17-9-18-14/h1-9H,(H,20,21)(H,17,18,19) |
| InChIKey | GKLUHJQWSJRFBO-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.18 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|