C18H16ClN7O2 — CID 19150628
N'-[5-amino-6-(2-benzoylhydrazinyl)pyrimidin-4-yl]-3-chlorobenzohydrazide (PubChem CID 19150628) has the molecular formula C18H16ClN7O2 and a molecular weight of 397.83 g/mol. Its IUPAC name is N'-[5-amino-6-(2-benzoylhydrazinyl)pyrimidin-4-yl]-3-chlorobenzohydrazide.
| Compound Name | N'-[5-amino-6-(2-benzoylhydrazinyl)pyrimidin-4-yl]-3-chlorobenzohydrazide |
|---|---|
| PubChem CID | 19150628 |
| Molecular Formula | C18H16ClN7O2 |
| Molecular Weight | 397.83 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | N'-[5-amino-6-(2-benzoylhydrazinyl)pyrimidin-4-yl]-3-chlorobenzohydrazide |
| SMILES | Nc1c(NNC(=O)c2ccccc2)ncnc1NNC(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C18H16ClN7O2/c19-13-8-4-7-12(9-13)18(28)26-24-16-14(20)15(21-10-22-16)23-25-17(27)11-5-2-1-3-6-11/h1-10H,20H2,(H,25,27)(H,26,28)(H2,21,22,23,24) |
| InChIKey | UHGHATDCCNOUIF-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 134.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.83 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|