C21H21Cl2N7O — CID 19139147
N'-[5-amino-6-[4-(3-chlorophenyl)piperazin-1-yl]pyrimidin-4-yl]-3-chlorobenzohydrazide (PubChem CID 19139147) has the molecular formula C21H21Cl2N7O and a molecular weight of 458.35 g/mol. Its IUPAC name is N'-[5-amino-6-[4-(3-chlorophenyl)piperazin-1-yl]pyrimidin-4-yl]-3-chlorobenzohydrazide.
| Compound Name | N'-[5-amino-6-[4-(3-chlorophenyl)piperazin-1-yl]pyrimidin-4-yl]-3-chlorobenzohydrazide |
|---|---|
| PubChem CID | 19139147 |
| Molecular Formula | C21H21Cl2N7O |
| Molecular Weight | 458.35 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | N'-[5-amino-6-[4-(3-chlorophenyl)piperazin-1-yl]pyrimidin-4-yl]-3-chlorobenzohydrazide |
| SMILES | Nc1c(NNC(=O)c2cccc(Cl)c2)ncnc1N1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C21H21Cl2N7O/c22-15-4-1-3-14(11-15)21(31)28-27-19-18(24)20(26-13-25-19)30-9-7-29(8-10-30)17-6-2-5-16(23)12-17/h1-6,11-13H,7-10,24H2,(H,28,31)(H,25,26,27) |
| InChIKey | WQLBRHROTTVLKV-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 99.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.35 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|