C28H28ClN7O — CID 19139156
N'-[5-amino-6-[4-(3-chlorophenyl)piperazin-1-yl]pyrimidin-4-yl]-2,2-diphenylacetohydrazide (PubChem CID 19139156) has the molecular formula C28H28ClN7O and a molecular weight of 514.03 g/mol. Its IUPAC name is N'-[5-amino-6-[4-(3-chlorophenyl)piperazin-1-yl]pyrimidin-4-yl]-2,2-diphenylacetohydrazide.
| Compound Name | N'-[5-amino-6-[4-(3-chlorophenyl)piperazin-1-yl]pyrimidin-4-yl]-2,2-diphenylacetohydrazide |
|---|---|
| PubChem CID | 19139156 |
| Molecular Formula | C28H28ClN7O |
| Molecular Weight | 514.03 g/mol |
| Exact Mass | 513.20 |
| IUPAC Name | N'-[5-amino-6-[4-(3-chlorophenyl)piperazin-1-yl]pyrimidin-4-yl]-2,2-diphenylacetohydrazide |
| SMILES | Nc1c(NNC(=O)C(c2ccccc2)c2ccccc2)ncnc1N1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C28H28ClN7O/c29-22-12-7-13-23(18-22)35-14-16-36(17-15-35)27-25(30)26(31-19-32-27)33-34-28(37)24(20-8-3-1-4-9-20)21-10-5-2-6-11-21/h1-13,18-19,24H,14-17,30H2,(H,34,37)(H,31,32,33) |
| InChIKey | IKXRVUUNDOIMRO-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 99.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.03 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|