C24H20Cl2N6O — CID 19146878
N'-[5-amino-6-(2,3-dichloroanilino)pyrimidin-4-yl]-2,2-diphenylacetohydrazide (PubChem CID 19146878) has the molecular formula C24H20Cl2N6O and a molecular weight of 479.37 g/mol. Its IUPAC name is N'-[5-amino-6-(2,3-dichloroanilino)pyrimidin-4-yl]-2,2-diphenylacetohydrazide.
| Compound Name | N'-[5-amino-6-(2,3-dichloroanilino)pyrimidin-4-yl]-2,2-diphenylacetohydrazide |
|---|---|
| PubChem CID | 19146878 |
| Molecular Formula | C24H20Cl2N6O |
| Molecular Weight | 479.37 g/mol |
| Exact Mass | 478.11 |
| IUPAC Name | N'-[5-amino-6-(2,3-dichloroanilino)pyrimidin-4-yl]-2,2-diphenylacetohydrazide |
| SMILES | Nc1c(NNC(=O)C(c2ccccc2)c2ccccc2)ncnc1Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C24H20Cl2N6O/c25-17-12-7-13-18(20(17)26)30-22-21(27)23(29-14-28-22)31-32-24(33)19(15-8-3-1-4-9-15)16-10-5-2-6-11-16/h1-14,19H,27H2,(H,32,33)(H2,28,29,30,31) |
| InChIKey | FXHMNRFQUGGYFA-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.37 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|