C26H26N6O2 — CID 22541949
N'-[5-amino-6-(2-methoxy-5-methylanilino)pyrimidin-4-yl]-2,2-diphenylacetohydrazide (PubChem CID 22541949) has the molecular formula C26H26N6O2 and a molecular weight of 454.53 g/mol. Its IUPAC name is N'-[5-amino-6-(2-methoxy-5-methylanilino)pyrimidin-4-yl]-2,2-diphenylacetohydrazide.
| Compound Name | N'-[5-amino-6-(2-methoxy-5-methylanilino)pyrimidin-4-yl]-2,2-diphenylacetohydrazide |
|---|---|
| PubChem CID | 22541949 |
| Molecular Formula | C26H26N6O2 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | N'-[5-amino-6-(2-methoxy-5-methylanilino)pyrimidin-4-yl]-2,2-diphenylacetohydrazide |
| SMILES | COc1ccc(C)cc1Nc1ncnc(NNC(=O)C(c2ccccc2)c2ccccc2)c1N |
| InChI | InChI=1S/C26H26N6O2/c1-17-13-14-21(34-2)20(15-17)30-24-23(27)25(29-16-28-24)31-32-26(33)22(18-9-5-3-6-10-18)19-11-7-4-8-12-19/h3-16,22H,27H2,1-2H3,(H,32,33)(H2,28,29,30,31) |
| InChIKey | OBJXYPWDFJQVDK-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 114.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|