C19H20N6O3 — CID 19142733
N'-[5-amino-6-(2,5-dimethoxyanilino)pyrimidin-4-yl]benzohydrazide (PubChem CID 19142733) has the molecular formula C19H20N6O3 and a molecular weight of 380.41 g/mol. Its IUPAC name is N'-[5-amino-6-(2,5-dimethoxyanilino)pyrimidin-4-yl]benzohydrazide.
| Compound Name | N'-[5-amino-6-(2,5-dimethoxyanilino)pyrimidin-4-yl]benzohydrazide |
|---|---|
| PubChem CID | 19142733 |
| Molecular Formula | C19H20N6O3 |
| Molecular Weight | 380.41 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | N'-[5-amino-6-(2,5-dimethoxyanilino)pyrimidin-4-yl]benzohydrazide |
| SMILES | COc1ccc(OC)c(Nc2ncnc(NNC(=O)c3ccccc3)c2N)c1 |
| InChI | InChI=1S/C19H20N6O3/c1-27-13-8-9-15(28-2)14(10-13)23-17-16(20)18(22-11-21-17)24-25-19(26)12-6-4-3-5-7-12/h3-11H,20H2,1-2H3,(H,25,26)(H2,21,22,23,24) |
| InChIKey | ICZAATUBVBFMPO-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 123.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.41 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|