C20H22N6O4 — CID 19142907
N'-[5-amino-6-(2,4-dimethoxyanilino)pyrimidin-4-yl]-2-phenoxyacetohydrazide (PubChem CID 19142907) has the molecular formula C20H22N6O4 and a molecular weight of 410.43 g/mol. Its IUPAC name is N'-[5-amino-6-(2,4-dimethoxyanilino)pyrimidin-4-yl]-2-phenoxyacetohydrazide.
| Compound Name | N'-[5-amino-6-(2,4-dimethoxyanilino)pyrimidin-4-yl]-2-phenoxyacetohydrazide |
|---|---|
| PubChem CID | 19142907 |
| Molecular Formula | C20H22N6O4 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | N'-[5-amino-6-(2,4-dimethoxyanilino)pyrimidin-4-yl]-2-phenoxyacetohydrazide |
| SMILES | COc1ccc(Nc2ncnc(NNC(=O)COc3ccccc3)c2N)c(OC)c1 |
| InChI | InChI=1S/C20H22N6O4/c1-28-14-8-9-15(16(10-14)29-2)24-19-18(21)20(23-12-22-19)26-25-17(27)11-30-13-6-4-3-5-7-13/h3-10,12H,11,21H2,1-2H3,(H,25,27)(H2,22,23,24,26) |
| InChIKey | JQKHQKASTLOLKZ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 132.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|