C20H20N6O4 — CID 19146255
methyl 2-[[5-amino-6-[2-(2-phenoxyacetyl)hydrazinyl]pyrimidin-4-yl]amino]benzoate (PubChem CID 19146255) has the molecular formula C20H20N6O4 and a molecular weight of 408.42 g/mol. Its IUPAC name is methyl 2-[[5-amino-6-[2-(2-phenoxyacetyl)hydrazinyl]pyrimidin-4-yl]amino]benzoate.
| Compound Name | methyl 2-[[5-amino-6-[2-(2-phenoxyacetyl)hydrazinyl]pyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 19146255 |
| Molecular Formula | C20H20N6O4 |
| Molecular Weight | 408.42 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | methyl 2-[[5-amino-6-[2-(2-phenoxyacetyl)hydrazinyl]pyrimidin-4-yl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1Nc1ncnc(NNC(=O)COc2ccccc2)c1N |
| InChI | InChI=1S/C20H20N6O4/c1-29-20(28)14-9-5-6-10-15(14)24-18-17(21)19(23-12-22-18)26-25-16(27)11-30-13-7-3-2-4-8-13/h2-10,12H,11,21H2,1H3,(H,25,27)(H2,22,23,24,26) |
| InChIKey | POHWQSYCTZSLPY-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 140.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.42 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|