C22H26N6O2 — CID 22540107
N'-[5-amino-6-(4-butylanilino)pyrimidin-4-yl]-2-phenoxyacetohydrazide (PubChem CID 22540107) has the molecular formula C22H26N6O2 and a molecular weight of 406.49 g/mol. Its IUPAC name is N'-[5-amino-6-(4-butylanilino)pyrimidin-4-yl]-2-phenoxyacetohydrazide.
| Compound Name | N'-[5-amino-6-(4-butylanilino)pyrimidin-4-yl]-2-phenoxyacetohydrazide |
|---|---|
| PubChem CID | 22540107 |
| Molecular Formula | C22H26N6O2 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | N'-[5-amino-6-(4-butylanilino)pyrimidin-4-yl]-2-phenoxyacetohydrazide |
| SMILES | CCCCc1ccc(Nc2ncnc(NNC(=O)COc3ccccc3)c2N)cc1 |
| InChI | InChI=1S/C22H26N6O2/c1-2-3-7-16-10-12-17(13-11-16)26-21-20(23)22(25-15-24-21)28-27-19(29)14-30-18-8-5-4-6-9-18/h4-6,8-13,15H,2-3,7,14,23H2,1H3,(H,27,29)(H2,24,25,26,28) |
| InChIKey | JYOWITXPIIMKTO-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 114.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|