C20H22FN5 — CID 22540036
6-N-(4-butylphenyl)-4-N-(2-fluorophenyl)pyrimidine-4,5,6-triamine (PubChem CID 22540036) has the molecular formula C20H22FN5 and a molecular weight of 351.43 g/mol. Its IUPAC name is 6-N-(4-butylphenyl)-4-N-(2-fluorophenyl)pyrimidine-4,5,6-triamine.
| Compound Name | 6-N-(4-butylphenyl)-4-N-(2-fluorophenyl)pyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 22540036 |
| Molecular Formula | C20H22FN5 |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | 6-N-(4-butylphenyl)-4-N-(2-fluorophenyl)pyrimidine-4,5,6-triamine |
| SMILES | CCCCc1ccc(Nc2ncnc(Nc3ccccc3F)c2N)cc1 |
| InChI | InChI=1S/C20H22FN5/c1-2-3-6-14-9-11-15(12-10-14)25-19-18(22)20(24-13-23-19)26-17-8-5-4-7-16(17)21/h4-5,7-13H,2-3,6,22H2,1H3,(H2,23,24,25,26) |
| InChIKey | RRVJXIQQEVHCJE-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |