C20H21N7 — CID 22540169
6-(benzotriazol-1-yl)-4-N-(4-butylphenyl)pyrimidine-4,5-diamine (PubChem CID 22540169) has the molecular formula C20H21N7 and a molecular weight of 359.44 g/mol. Its IUPAC name is 6-(benzotriazol-1-yl)-4-N-(4-butylphenyl)pyrimidine-4,5-diamine.
| Compound Name | 6-(benzotriazol-1-yl)-4-N-(4-butylphenyl)pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 22540169 |
| Molecular Formula | C20H21N7 |
| Molecular Weight | 359.44 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | 6-(benzotriazol-1-yl)-4-N-(4-butylphenyl)pyrimidine-4,5-diamine |
| SMILES | CCCCc1ccc(Nc2ncnc(-n3nnc4ccccc43)c2N)cc1 |
| InChI | InChI=1S/C20H21N7/c1-2-3-6-14-9-11-15(12-10-14)24-19-18(21)20(23-13-22-19)27-17-8-5-4-7-16(17)25-26-27/h4-5,7-13H,2-3,6,21H2,1H3,(H,22,23,24) |
| InChIKey | OYTQQNKBFUJXLU-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 94.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.44 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |