C16H12IN7 — CID 19148985
6-(benzotriazol-1-yl)-4-N-(4-iodophenyl)pyrimidine-4,5-diamine (PubChem CID 19148985) has the molecular formula C16H12IN7 and a molecular weight of 429.23 g/mol. Its IUPAC name is 6-(benzotriazol-1-yl)-4-N-(4-iodophenyl)pyrimidine-4,5-diamine.
| Compound Name | 6-(benzotriazol-1-yl)-4-N-(4-iodophenyl)pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 19148985 |
| Molecular Formula | C16H12IN7 |
| Molecular Weight | 429.23 g/mol |
| Exact Mass | 429.02 |
| IUPAC Name | 6-(benzotriazol-1-yl)-4-N-(4-iodophenyl)pyrimidine-4,5-diamine |
| SMILES | Nc1c(Nc2ccc(I)cc2)ncnc1-n1nnc2ccccc21 |
| InChI | InChI=1S/C16H12IN7/c17-10-5-7-11(8-6-10)21-15-14(18)16(20-9-19-15)24-13-4-2-1-3-12(13)22-23-24/h1-9H,18H2,(H,19,20,21) |
| InChIKey | BRWXOYFXXAURRH-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 94.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.23 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|