C18H16N8O — CID 19150956
N'-[5-amino-6-(benzotriazol-1-yl)pyrimidin-4-yl]-2-methylbenzohydrazide (PubChem CID 19150956) has the molecular formula C18H16N8O and a molecular weight of 360.38 g/mol. Its IUPAC name is N'-[5-amino-6-(benzotriazol-1-yl)pyrimidin-4-yl]-2-methylbenzohydrazide.
| Compound Name | N'-[5-amino-6-(benzotriazol-1-yl)pyrimidin-4-yl]-2-methylbenzohydrazide |
|---|---|
| PubChem CID | 19150956 |
| Molecular Formula | C18H16N8O |
| Molecular Weight | 360.38 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | N'-[5-amino-6-(benzotriazol-1-yl)pyrimidin-4-yl]-2-methylbenzohydrazide |
| SMILES | Cc1ccccc1C(=O)NNc1ncnc(-n2nnc3ccccc32)c1N |
| InChI | InChI=1S/C18H16N8O/c1-11-6-2-3-7-12(11)18(27)24-23-16-15(19)17(21-10-20-16)26-14-9-5-4-8-13(14)22-25-26/h2-10H,19H2,1H3,(H,24,27)(H,20,21,23) |
| InChIKey | BWNSWZAFSPGGSE-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 123.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.38 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|