C15H18N6O — CID 19136045
N'-[5-amino-6-(prop-2-enylamino)pyrimidin-4-yl]-2-methylbenzohydrazide (PubChem CID 19136045) has the molecular formula C15H18N6O and a molecular weight of 298.35 g/mol. Its IUPAC name is N'-[5-amino-6-(prop-2-enylamino)pyrimidin-4-yl]-2-methylbenzohydrazide.
| Compound Name | N'-[5-amino-6-(prop-2-enylamino)pyrimidin-4-yl]-2-methylbenzohydrazide |
|---|---|
| PubChem CID | 19136045 |
| Molecular Formula | C15H18N6O |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | N'-[5-amino-6-(prop-2-enylamino)pyrimidin-4-yl]-2-methylbenzohydrazide |
| SMILES | C=CCNc1ncnc(NNC(=O)c2ccccc2C)c1N |
| InChI | InChI=1S/C15H18N6O/c1-3-8-17-13-12(16)14(19-9-18-13)20-21-15(22)11-7-5-4-6-10(11)2/h3-7,9H,1,8,16H2,2H3,(H,21,22)(H2,17,18,19,20) |
| InChIKey | UQWUPDSKTQBSNA-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|