C14H15ClN6O — CID 19136050
N'-[5-amino-6-(prop-2-enylamino)pyrimidin-4-yl]-2-chlorobenzohydrazide (PubChem CID 19136050) has the molecular formula C14H15ClN6O and a molecular weight of 318.77 g/mol. Its IUPAC name is N'-[5-amino-6-(prop-2-enylamino)pyrimidin-4-yl]-2-chlorobenzohydrazide.
| Compound Name | N'-[5-amino-6-(prop-2-enylamino)pyrimidin-4-yl]-2-chlorobenzohydrazide |
|---|---|
| PubChem CID | 19136050 |
| Molecular Formula | C14H15ClN6O |
| Molecular Weight | 318.77 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | N'-[5-amino-6-(prop-2-enylamino)pyrimidin-4-yl]-2-chlorobenzohydrazide |
| SMILES | C=CCNc1ncnc(NNC(=O)c2ccccc2Cl)c1N |
| InChI | InChI=1S/C14H15ClN6O/c1-2-7-17-12-11(16)13(19-8-18-12)20-21-14(22)9-5-3-4-6-10(9)15/h2-6,8H,1,7,16H2,(H,21,22)(H2,17,18,19,20) |
| InChIKey | MWXMAAMUGIQEDH-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.77 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|