C14H16Cl2N6O — CID 19135477
N'-[5-amino-6-(propylamino)pyrimidin-4-yl]-2,4-dichlorobenzohydrazide (PubChem CID 19135477) has the molecular formula C14H16Cl2N6O and a molecular weight of 355.23 g/mol. Its IUPAC name is N'-[5-amino-6-(propylamino)pyrimidin-4-yl]-2,4-dichlorobenzohydrazide.
| Compound Name | N'-[5-amino-6-(propylamino)pyrimidin-4-yl]-2,4-dichlorobenzohydrazide |
|---|---|
| PubChem CID | 19135477 |
| Molecular Formula | C14H16Cl2N6O |
| Molecular Weight | 355.23 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | N'-[5-amino-6-(propylamino)pyrimidin-4-yl]-2,4-dichlorobenzohydrazide |
| SMILES | CCCNc1ncnc(NNC(=O)c2ccc(Cl)cc2Cl)c1N |
| InChI | InChI=1S/C14H16Cl2N6O/c1-2-5-18-12-11(17)13(20-7-19-12)21-22-14(23)9-4-3-8(15)6-10(9)16/h3-4,6-7H,2,5,17H2,1H3,(H,22,23)(H2,18,19,20,21) |
| InChIKey | WYBAAHRCWBFFKB-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.23 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|