C19H18Cl2N6O — CID 22539627
N'-[5-amino-6-[benzyl(methyl)amino]pyrimidin-4-yl]-2,4-dichlorobenzohydrazide (PubChem CID 22539627) has the molecular formula C19H18Cl2N6O and a molecular weight of 417.30 g/mol. Its IUPAC name is N'-[5-amino-6-[benzyl(methyl)amino]pyrimidin-4-yl]-2,4-dichlorobenzohydrazide.
| Compound Name | N'-[5-amino-6-[benzyl(methyl)amino]pyrimidin-4-yl]-2,4-dichlorobenzohydrazide |
|---|---|
| PubChem CID | 22539627 |
| Molecular Formula | C19H18Cl2N6O |
| Molecular Weight | 417.30 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | N'-[5-amino-6-[benzyl(methyl)amino]pyrimidin-4-yl]-2,4-dichlorobenzohydrazide |
| SMILES | CN(Cc1ccccc1)c1ncnc(NNC(=O)c2ccc(Cl)cc2Cl)c1N |
| InChI | InChI=1S/C19H18Cl2N6O/c1-27(10-12-5-3-2-4-6-12)18-16(22)17(23-11-24-18)25-26-19(28)14-8-7-13(20)9-15(14)21/h2-9,11H,10,22H2,1H3,(H,26,28)(H,23,24,25) |
| InChIKey | ACXHYNAPGUYMSM-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.30 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|