C23H20ClN7O — CID 19151321
N'-[5-amino-6-[benzyl(pyridin-2-yl)amino]pyrimidin-4-yl]-2-chlorobenzohydrazide (PubChem CID 19151321) has the molecular formula C23H20ClN7O and a molecular weight of 445.91 g/mol. Its IUPAC name is N'-[5-amino-6-[benzyl(pyridin-2-yl)amino]pyrimidin-4-yl]-2-chlorobenzohydrazide.
| Compound Name | N'-[5-amino-6-[benzyl(pyridin-2-yl)amino]pyrimidin-4-yl]-2-chlorobenzohydrazide |
|---|---|
| PubChem CID | 19151321 |
| Molecular Formula | C23H20ClN7O |
| Molecular Weight | 445.91 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | N'-[5-amino-6-[benzyl(pyridin-2-yl)amino]pyrimidin-4-yl]-2-chlorobenzohydrazide |
| SMILES | Nc1c(NNC(=O)c2ccccc2Cl)ncnc1N(Cc1ccccc1)c1ccccn1 |
| InChI | InChI=1S/C23H20ClN7O/c24-18-11-5-4-10-17(18)23(32)30-29-21-20(25)22(28-15-27-21)31(19-12-6-7-13-26-19)14-16-8-2-1-3-9-16/h1-13,15H,14,25H2,(H,30,32)(H,27,28,29) |
| InChIKey | YNVJEHLLXSLHTJ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 109.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.91 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|