C23H18BrN7O3 — CID 22535475
N'-[6-[benzyl(pyridin-2-yl)amino]-5-nitropyrimidin-4-yl]-4-bromobenzohydrazide (PubChem CID 22535475) has the molecular formula C23H18BrN7O3 and a molecular weight of 520.35 g/mol. Its IUPAC name is N'-[6-[benzyl(pyridin-2-yl)amino]-5-nitropyrimidin-4-yl]-4-bromobenzohydrazide.
| Compound Name | N'-[6-[benzyl(pyridin-2-yl)amino]-5-nitropyrimidin-4-yl]-4-bromobenzohydrazide |
|---|---|
| PubChem CID | 22535475 |
| Molecular Formula | C23H18BrN7O3 |
| Molecular Weight | 520.35 g/mol |
| Exact Mass | 519.07 |
| IUPAC Name | N'-[6-[benzyl(pyridin-2-yl)amino]-5-nitropyrimidin-4-yl]-4-bromobenzohydrazide |
| SMILES | O=C(NNc1ncnc(N(Cc2ccccc2)c2ccccn2)c1[N+](=O)[O-])c1ccc(Br)cc1 |
| InChI | InChI=1S/C23H18BrN7O3/c24-18-11-9-17(10-12-18)23(32)29-28-21-20(31(33)34)22(27-15-26-21)30(19-8-4-5-13-25-19)14-16-6-2-1-3-7-16/h1-13,15H,14H2,(H,29,32)(H,26,27,28) |
| InChIKey | RAQJSGJVFKVAOR-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 126.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.35 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|