C23H18N6O4 — CID 22538320
4-[[6-[benzyl(pyridin-2-yl)amino]-5-nitropyrimidin-4-yl]amino]benzoic acid (PubChem CID 22538320) has the molecular formula C23H18N6O4 and a molecular weight of 442.44 g/mol. Its IUPAC name is 4-[[6-[benzyl(pyridin-2-yl)amino]-5-nitropyrimidin-4-yl]amino]benzoic acid.
| Compound Name | 4-[[6-[benzyl(pyridin-2-yl)amino]-5-nitropyrimidin-4-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 22538320 |
| Molecular Formula | C23H18N6O4 |
| Molecular Weight | 442.44 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | 4-[[6-[benzyl(pyridin-2-yl)amino]-5-nitropyrimidin-4-yl]amino]benzoic acid |
| SMILES | O=C(O)c1ccc(Nc2ncnc(N(Cc3ccccc3)c3ccccn3)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H18N6O4/c30-23(31)17-9-11-18(12-10-17)27-21-20(29(32)33)22(26-15-25-21)28(19-8-4-5-13-24-19)14-16-6-2-1-3-7-16/h1-13,15H,14H2,(H,30,31)(H,25,26,27) |
| InChIKey | MOQVKEIPRFATDL-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 134.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.44 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|