C26H23N5O3 — CID 23488349
1-[4-[[6-(dibenzylamino)-5-nitropyrimidin-4-yl]amino]phenyl]ethanone (PubChem CID 23488349) has the molecular formula C26H23N5O3 and a molecular weight of 453.50 g/mol. Its IUPAC name is 1-[4-[[6-(dibenzylamino)-5-nitropyrimidin-4-yl]amino]phenyl]ethanone.
| Compound Name | 1-[4-[[6-(dibenzylamino)-5-nitropyrimidin-4-yl]amino]phenyl]ethanone |
|---|---|
| PubChem CID | 23488349 |
| Molecular Formula | C26H23N5O3 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | 1-[4-[[6-(dibenzylamino)-5-nitropyrimidin-4-yl]amino]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(Nc2ncnc(N(Cc3ccccc3)Cc3ccccc3)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C26H23N5O3/c1-19(32)22-12-14-23(15-13-22)29-25-24(31(33)34)26(28-18-27-25)30(16-20-8-4-2-5-9-20)17-21-10-6-3-7-11-21/h2-15,18H,16-17H2,1H3,(H,27,28,29) |
| InChIKey | IOAHGDXQXMGWFC-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 101.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|