C15H11N7O4 — CID 23493421
4-[[6-[bis(cyanomethyl)amino]-5-nitropyrimidin-4-yl]amino]benzoic acid (PubChem CID 23493421) has the molecular formula C15H11N7O4 and a molecular weight of 353.30 g/mol. Its IUPAC name is 4-[[6-[bis(cyanomethyl)amino]-5-nitropyrimidin-4-yl]amino]benzoic acid.
| Compound Name | 4-[[6-[bis(cyanomethyl)amino]-5-nitropyrimidin-4-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 23493421 |
| Molecular Formula | C15H11N7O4 |
| Molecular Weight | 353.30 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | 4-[[6-[bis(cyanomethyl)amino]-5-nitropyrimidin-4-yl]amino]benzoic acid |
| SMILES | N#CCN(CC#N)c1ncnc(Nc2ccc(C(=O)O)cc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H11N7O4/c16-5-7-21(8-6-17)14-12(22(25)26)13(18-9-19-14)20-11-3-1-10(2-4-11)15(23)24/h1-4,9H,7-8H2,(H,23,24)(H,18,19,20) |
| InChIKey | JJTFTHPIEDYXSU-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 169.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.30 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|