C15H11ClN8O3 — CID 23493359
N'-[6-[bis(cyanomethyl)amino]-5-nitropyrimidin-4-yl]-3-chlorobenzohydrazide (PubChem CID 23493359) has the molecular formula C15H11ClN8O3 and a molecular weight of 386.76 g/mol. Its IUPAC name is N'-[6-[bis(cyanomethyl)amino]-5-nitropyrimidin-4-yl]-3-chlorobenzohydrazide.
| Compound Name | N'-[6-[bis(cyanomethyl)amino]-5-nitropyrimidin-4-yl]-3-chlorobenzohydrazide |
|---|---|
| PubChem CID | 23493359 |
| Molecular Formula | C15H11ClN8O3 |
| Molecular Weight | 386.76 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | N'-[6-[bis(cyanomethyl)amino]-5-nitropyrimidin-4-yl]-3-chlorobenzohydrazide |
| SMILES | N#CCN(CC#N)c1ncnc(NNC(=O)c2cccc(Cl)c2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H11ClN8O3/c16-11-3-1-2-10(8-11)15(25)22-21-13-12(24(26)27)14(20-9-19-13)23(6-4-17)7-5-18/h1-3,8-9H,6-7H2,(H,22,25)(H,19,20,21) |
| InChIKey | OAULOWWTDNVGME-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 160.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.76 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|