C17H13ClN8O5 — CID 22526838
3-chloro-N'-[5-nitro-6-[2-(4-nitrophenyl)hydrazinyl]pyrimidin-4-yl]benzohydrazide (PubChem CID 22526838) has the molecular formula C17H13ClN8O5 and a molecular weight of 444.80 g/mol. Its IUPAC name is 3-chloro-N'-[5-nitro-6-[2-(4-nitrophenyl)hydrazinyl]pyrimidin-4-yl]benzohydrazide.
| Compound Name | 3-chloro-N'-[5-nitro-6-[2-(4-nitrophenyl)hydrazinyl]pyrimidin-4-yl]benzohydrazide |
|---|---|
| PubChem CID | 22526838 |
| Molecular Formula | C17H13ClN8O5 |
| Molecular Weight | 444.80 g/mol |
| Exact Mass | 444.07 |
| IUPAC Name | 3-chloro-N'-[5-nitro-6-[2-(4-nitrophenyl)hydrazinyl]pyrimidin-4-yl]benzohydrazide |
| SMILES | O=C(NNc1ncnc(NNc2ccc([N+](=O)[O-])cc2)c1[N+](=O)[O-])c1cccc(Cl)c1 |
| InChI | InChI=1S/C17H13ClN8O5/c18-11-3-1-2-10(8-11)17(27)24-23-16-14(26(30)31)15(19-9-20-16)22-21-12-4-6-13(7-5-12)25(28)29/h1-9,21H,(H,24,27)(H2,19,20,22,23) |
| InChIKey | AEBANKGUPDDXPF-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 177.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.80 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|