C18H12ClF3N6O3 — CID 22532642
3-chloro-N'-[5-nitro-6-[3-(trifluoromethyl)anilino]pyrimidin-4-yl]benzohydrazide (PubChem CID 22532642) has the molecular formula C18H12ClF3N6O3 and a molecular weight of 452.78 g/mol. Its IUPAC name is 3-chloro-N'-[5-nitro-6-[3-(trifluoromethyl)anilino]pyrimidin-4-yl]benzohydrazide.
| Compound Name | 3-chloro-N'-[5-nitro-6-[3-(trifluoromethyl)anilino]pyrimidin-4-yl]benzohydrazide |
|---|---|
| PubChem CID | 22532642 |
| Molecular Formula | C18H12ClF3N6O3 |
| Molecular Weight | 452.78 g/mol |
| Exact Mass | 452.06 |
| IUPAC Name | 3-chloro-N'-[5-nitro-6-[3-(trifluoromethyl)anilino]pyrimidin-4-yl]benzohydrazide |
| SMILES | O=C(NNc1ncnc(Nc2cccc(C(F)(F)F)c2)c1[N+](=O)[O-])c1cccc(Cl)c1 |
| InChI | InChI=1S/C18H12ClF3N6O3/c19-12-5-1-3-10(7-12)17(29)27-26-16-14(28(30)31)15(23-9-24-16)25-13-6-2-4-11(8-13)18(20,21)22/h1-9H,(H,27,29)(H2,23,24,25,26) |
| InChIKey | FIRHFLCBANTTJD-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 122.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.78 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|