C18H15ClN6O3 — CID 22532517
N'-[6-(3-chloroanilino)-5-nitropyrimidin-4-yl]-2-methylbenzohydrazide (PubChem CID 22532517) has the molecular formula C18H15ClN6O3 and a molecular weight of 398.81 g/mol. Its IUPAC name is N'-[6-(3-chloroanilino)-5-nitropyrimidin-4-yl]-2-methylbenzohydrazide.
| Compound Name | N'-[6-(3-chloroanilino)-5-nitropyrimidin-4-yl]-2-methylbenzohydrazide |
|---|---|
| PubChem CID | 22532517 |
| Molecular Formula | C18H15ClN6O3 |
| Molecular Weight | 398.81 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | N'-[6-(3-chloroanilino)-5-nitropyrimidin-4-yl]-2-methylbenzohydrazide |
| SMILES | Cc1ccccc1C(=O)NNc1ncnc(Nc2cccc(Cl)c2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C18H15ClN6O3/c1-11-5-2-3-8-14(11)18(26)24-23-17-15(25(27)28)16(20-10-21-17)22-13-7-4-6-12(19)9-13/h2-10H,1H3,(H,24,26)(H2,20,21,22,23) |
| InChIKey | LXXOBEPCBOPHBR-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 122.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.81 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|