C19H16N6O5 — CID 22535327
4-[[6-[2-(2-methylbenzoyl)hydrazinyl]-5-nitropyrimidin-4-yl]amino]benzoic acid (PubChem CID 22535327) has the molecular formula C19H16N6O5 and a molecular weight of 408.37 g/mol. Its IUPAC name is 4-[[6-[2-(2-methylbenzoyl)hydrazinyl]-5-nitropyrimidin-4-yl]amino]benzoic acid.
| Compound Name | 4-[[6-[2-(2-methylbenzoyl)hydrazinyl]-5-nitropyrimidin-4-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 22535327 |
| Molecular Formula | C19H16N6O5 |
| Molecular Weight | 408.37 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | 4-[[6-[2-(2-methylbenzoyl)hydrazinyl]-5-nitropyrimidin-4-yl]amino]benzoic acid |
| SMILES | Cc1ccccc1C(=O)NNc1ncnc(Nc2ccc(C(=O)O)cc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C19H16N6O5/c1-11-4-2-3-5-14(11)18(26)24-23-17-15(25(29)30)16(20-10-21-17)22-13-8-6-12(7-9-13)19(27)28/h2-10H,1H3,(H,24,26)(H,27,28)(H2,20,21,22,23) |
| InChIKey | GFFAMNJVHPZPBD-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 159.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.37 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|